Products 1352524-58-3

CAS 1352524-58-3 is the registry number for 2-(4-Methoxybenzyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[(4-methoxyphenyl)methyl]-1-oxoisoquinoline-4-carboxylic acid (CAS 1352524-58-3) is a chemical compound with the molecular formula C18H15NO4 and a molecular weight of 309.3 g/mol. IUPAC name: 2-[(4-methoxyphenyl)methyl]-1-oxoisoquinoline-4-carboxylic acid. InChIKey: DHWHOIWMOJPESM-UHFFFAOYSA-N.

Identity
Molecular formulaC18H15NO4
Molecular weight309.3 g/mol
IUPAC name2-[(4-methoxyphenyl)methyl]-1-oxoisoquinoline-4-carboxylic acid
InChIKeyDHWHOIWMOJPESM-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)CN2C=C(C3=CC=CC=C3C2=O)C(=O)O

Computed by PubChem (NCBI)