CAS 929028-73-9 is the registry number for 6-Benzyloxy-4-oxo-1,4-dihydro-quinoline-2-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Methyl 4-oxo-6-phenylmethoxy-1H-quinoline-2-carboxylate (CAS 929028-73-9) is a chemical compound with the molecular formula C18H15NO4 and a molecular weight of 309.3 g/mol. IUPAC name: methyl 4-oxo-6-phenylmethoxy-1H-quinoline-2-carboxylate. InChIKey: ISEUSWBMFAUWGC-UHFFFAOYSA-N.
| Molecular formula | C18H15NO4 |
|---|---|
| Molecular weight | 309.3 g/mol |
| IUPAC name | methyl 4-oxo-6-phenylmethoxy-1H-quinoline-2-carboxylate |
| InChIKey | ISEUSWBMFAUWGC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=O)C2=C(N1)C=CC(=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)