2-(3-Amino-3-oxopropyl)malonic acid, 97%
cas: 2682114-22-1 — see every product listed under this CAS number, including other names
2-(3-Amino-3-oxopropyl)malonic acid, 97% (CAS 2682114-22-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1351243-100mg |
| cas | 2682114-22-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 1900.06 Pln | |
| Chemat | 100mg | 237.20 Pln | |
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 1g | 707.60 Pln | |
| BLDpharm | 100mg | 247.72 Pln | |
| BLDpharm | 250mg | 336.57 Pln | |
| BLDpharm | 1g | 608.70 Pln | |
| BLDpharm | 5g | 2041.53 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-(3-amino-3-oxopropyl)propanedioic acid (CAS 2682114-22-1) is a chemical compound with the molecular formula C6H9NO5 and a molecular weight of 175.14 g/mol. IUPAC name: 2-(3-amino-3-oxopropyl)propanedioic acid. InChIKey: YTAZOLZSNLLHLI-UHFFFAOYSA-N.
| Molecular formula | C6H9NO5 |
|---|---|
| Molecular weight | 175.14 g/mol |
| IUPAC name | 2-(3-amino-3-oxopropyl)propanedioic acid |
| InChIKey | YTAZOLZSNLLHLI-UHFFFAOYSA-N |
| SMILES | C(CC(=O)N)C(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)