Products 175220-76-5

CAS 175220-76-5 is the registry number for Isosorbide Impurity 18. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[(3S,3aR,6R,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrite (CAS 175220-76-5) is a chemical compound with the molecular formula C6H9NO5 and a molecular weight of 175.14 g/mol. IUPAC name: [(3S,3aR,6R,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrite. InChIKey: YIDASVHWZDJRTC-SLPGGIOYSA-N.

Identity
Molecular formulaC6H9NO5
Molecular weight175.14 g/mol
IUPAC name[(3S,3aR,6R,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrite
InChIKeyYIDASVHWZDJRTC-SLPGGIOYSA-N
SMILESC1[C@@H]([C@@H]2[C@H](O1)[C@@H](CO2)ON=O)O

Computed by PubChem (NCBI)