Products 2682114-22-1
CAS 2682114-22-1 appears in our catalog under these names: 2-(3-Amino-3-oxopropyl)malonic acid 97%, 2-(3-Amino-3-oxopropyl)malonic acid, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(3-amino-3-oxopropyl)propanedioic acid (CAS 2682114-22-1) is a chemical compound with the molecular formula C6H9NO5 and a molecular weight of 175.14 g/mol. IUPAC name: 2-(3-amino-3-oxopropyl)propanedioic acid. InChIKey: YTAZOLZSNLLHLI-UHFFFAOYSA-N.
| Molecular formula | C6H9NO5 |
|---|---|
| Molecular weight | 175.14 g/mol |
| IUPAC name | 2-(3-amino-3-oxopropyl)propanedioic acid |
| InChIKey | YTAZOLZSNLLHLI-UHFFFAOYSA-N |
| SMILES | C(CC(=O)N)C(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)