Products 1383929-94-9
CAS 1383929-94-9 appears in our catalog under these names: N-Acetyl -L-Aspartic Acid-d3, >95% (HPLC), N–Acetyl –L–Aspartic Acid–d3, N-Acetyl-L-aspartic acid-d3-1, 99.0%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 50mg, 1 mg.
(2S)-2-[(2,2,2-trideuterioacetyl)amino]butanedioic acid (CAS 1383929-94-9) is a chemical compound with the molecular formula C6H9NO5 and a molecular weight of 178.16 g/mol. IUPAC name: (2S)-2-[(2,2,2-trideuterioacetyl)amino]butanedioic acid. InChIKey: OTCCIMWXFLJLIA-OSIBIXDNSA-N.
| Molecular formula | C6H9NO5 |
|---|---|
| Molecular weight | 178.16 g/mol |
| IUPAC name | (2S)-2-[(2,2,2-trideuterioacetyl)amino]butanedioic acid |
| InChIKey | OTCCIMWXFLJLIA-OSIBIXDNSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)N[C@@H](CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)