Products 89829-69-6
CAS 89829-69-6 appears in our catalog under these names: N-Acetyl-D,L-Aspartic Acid 2,3,3-D3, >95% (HPLC), N-Acetyl-DL-aspartic-2,3,3-d3 Acid, 98 atom % D, min 97% Chemical Purity, N-Acetyl-DL-aspartic acid-2,3,3-d3. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 0,05g, 0,01g, 10 mg.
2-acetamido-2,3,3-trideuteriobutanedioic acid (CAS 89829-69-6) is a chemical compound with the molecular formula C6H9NO5 and a molecular weight of 178.16 g/mol. IUPAC name: 2-acetamido-2,3,3-trideuteriobutanedioic acid. InChIKey: OTCCIMWXFLJLIA-OVLJBECYSA-N.
| Molecular formula | C6H9NO5 |
|---|---|
| Molecular weight | 178.16 g/mol |
| IUPAC name | 2-acetamido-2,3,3-trideuteriobutanedioic acid |
| InChIKey | OTCCIMWXFLJLIA-OVLJBECYSA-N |
| SMILES | [2H]C([2H])(C(=O)O)C([2H])(C(=O)O)NC(=O)C |
Computed by PubChem (NCBI)