CAS 51026-98-3 is the registry number for Ethyl Nitroacetoacetate. Offered by: TRC. Available pack sizes: 1g.
Ethyl 2-nitro-3-oxobutanoate (CAS 51026-98-3) is a chemical compound with the molecular formula C6H9NO5 and a molecular weight of 175.14 g/mol. IUPAC name: ethyl 2-nitro-3-oxobutanoate. InChIKey: RYJZCTRVMDSKSF-UHFFFAOYSA-N.
| Molecular formula | C6H9NO5 |
|---|---|
| Molecular weight | 175.14 g/mol |
| IUPAC name | ethyl 2-nitro-3-oxobutanoate |
| InChIKey | RYJZCTRVMDSKSF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)