Products 98196-97-5
CAS 98196-97-5 is the registry number for 6-Nitro-4-oxohexanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-nitro-4-oxohexanoic acid (CAS 98196-97-5) is a chemical compound with the molecular formula C6H9NO5 and a molecular weight of 175.14 g/mol. IUPAC name: 6-nitro-4-oxohexanoic acid. InChIKey: XIILZEKSMDUWKM-UHFFFAOYSA-N.
| Molecular formula | C6H9NO5 |
|---|---|
| Molecular weight | 175.14 g/mol |
| IUPAC name | 6-nitro-4-oxohexanoic acid |
| InChIKey | XIILZEKSMDUWKM-UHFFFAOYSA-N |
| SMILES | C(CC(=O)O)C(=O)CC[N+](=O)[O-] |
Computed by PubChem (NCBI)