CAS 85553-51-1 is the registry number for 2-(3-Bromophenyl)furan, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.
2-(3-bromophenyl)furan (CAS 85553-51-1) is a chemical compound with the molecular formula C10H7BrO and a molecular weight of 223.07 g/mol. IUPAC name: 2-(3-bromophenyl)furan. InChIKey: YQTIZEZABLIGPW-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 2-(3-bromophenyl)furan |
| InChIKey | YQTIZEZABLIGPW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=CC=CO2 |
Computed by PubChem (NCBI)