cas: 19667-37-9 — see every product listed under this CAS number, including other names
2-(3-CHLORO-2-HYDROXYPROPYL)-1H-ISOINDOLE-1,3(2H)-DIONE, 98%, 98% (CAS 19667-37-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AWZ6-100mg |
| cas | 19667-37-9 |
| size | 100mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 285.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(3-chloro-2-hydroxypropyl)isoindole-1,3-dione (CAS 19667-37-9) is a chemical compound with the molecular formula C11H10ClNO3 and a molecular weight of 239.65 g/mol. IUPAC name: 2-(3-chloro-2-hydroxypropyl)isoindole-1,3-dione. InChIKey: KBRVYEPWGIQEOF-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO3 |
|---|---|
| Molecular weight | 239.65 g/mol |
| IUPAC name | 2-(3-chloro-2-hydroxypropyl)isoindole-1,3-dione |
| InChIKey | KBRVYEPWGIQEOF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC(CCl)O |
Computed by PubChem (NCBI)