cas: 19667-37-9 — see every product listed under this CAS number, including other names
2-(3-Chloro-2-hydroxypropyl)isoindoline-1,3-dione, 98% (CAS 19667-37-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A662294-5g |
| cas | 19667-37-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 7973.14 Pln | |
| Fluorochem | 100mg | 346.77 Pln | |
| Fluorochem | 250mg | 633.13 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(3-chloro-2-hydroxypropyl)isoindole-1,3-dione (CAS 19667-37-9) is a chemical compound with the molecular formula C11H10ClNO3 and a molecular weight of 239.65 g/mol. IUPAC name: 2-(3-chloro-2-hydroxypropyl)isoindole-1,3-dione. InChIKey: KBRVYEPWGIQEOF-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO3 |
|---|---|
| Molecular weight | 239.65 g/mol |
| IUPAC name | 2-(3-chloro-2-hydroxypropyl)isoindole-1,3-dione |
| InChIKey | KBRVYEPWGIQEOF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC(CCl)O |
Computed by PubChem (NCBI)