cas: 2432848-92-3 — see every product listed under this CAS number, including other names
2-(3-Chloro-2,4-difluorophenyl)-1,3-dioxolane, 98% (CAS 2432848-92-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1656423-25g |
| cas | 2432848-92-3 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 9887.08 Pln | |
| AmBeed | 10g | 5063.17 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(3-chloro-2,4-difluorophenyl)-1,3-dioxolane (CAS 2432848-92-3) is a chemical compound with the molecular formula C9H7ClF2O2 and a molecular weight of 220.60 g/mol. IUPAC name: 2-(3-chloro-2,4-difluorophenyl)-1,3-dioxolane. InChIKey: CNKKQMDVFOJJDL-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O2 |
|---|---|
| Molecular weight | 220.60 g/mol |
| IUPAC name | 2-(3-chloro-2,4-difluorophenyl)-1,3-dioxolane |
| InChIKey | CNKKQMDVFOJJDL-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C(=C(C=C2)F)Cl)F |
Computed by PubChem (NCBI)