CAS 1261541-73-4 is the registry number for Ethyl 2-chloro-3,4-difluorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
Ethyl 2-chloro-3,4-difluorobenzoate (CAS 1261541-73-4) is a chemical compound with the molecular formula C9H7ClF2O2 and a molecular weight of 220.60 g/mol. IUPAC name: ethyl 2-chloro-3,4-difluorobenzoate. InChIKey: XXZSZRJZNNJKFL-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O2 |
|---|---|
| Molecular weight | 220.60 g/mol |
| IUPAC name | ethyl 2-chloro-3,4-difluorobenzoate |
| InChIKey | XXZSZRJZNNJKFL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(C=C1)F)F)Cl |
Computed by PubChem (NCBI)