Products 1782332-00-6

CAS 1782332-00-6 is the registry number for methyl 2-(2-chlorophenyl)-2,2-difluoroacetate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 2-(2-chlorophenyl)-2,2-difluoroacetate (CAS 1782332-00-6) is a chemical compound with the molecular formula C9H7ClF2O2 and a molecular weight of 220.60 g/mol. IUPAC name: methyl 2-(2-chlorophenyl)-2,2-difluoroacetate. InChIKey: CEMQXYMELNVHCH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7ClF2O2
Molecular weight220.60 g/mol
IUPAC namemethyl 2-(2-chlorophenyl)-2,2-difluoroacetate
InChIKeyCEMQXYMELNVHCH-UHFFFAOYSA-N
SMILESCOC(=O)C(C1=CC=CC=C1Cl)(F)F

Computed by PubChem (NCBI)