CAS 1782332-00-6 is the registry number for methyl 2-(2-chlorophenyl)-2,2-difluoroacetate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl 2-(2-chlorophenyl)-2,2-difluoroacetate (CAS 1782332-00-6) is a chemical compound with the molecular formula C9H7ClF2O2 and a molecular weight of 220.60 g/mol. IUPAC name: methyl 2-(2-chlorophenyl)-2,2-difluoroacetate. InChIKey: CEMQXYMELNVHCH-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O2 |
|---|---|
| Molecular weight | 220.60 g/mol |
| IUPAC name | methyl 2-(2-chlorophenyl)-2,2-difluoroacetate |
| InChIKey | CEMQXYMELNVHCH-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC=CC=C1Cl)(F)F |
Computed by PubChem (NCBI)