CAS 761459-04-5 is the registry number for 4-Ethoxy-2,3-difluorobenzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-ethoxy-2,3-difluorobenzoyl chloride (CAS 761459-04-5) is a chemical compound with the molecular formula C9H7ClF2O2 and a molecular weight of 220.60 g/mol. IUPAC name: 4-ethoxy-2,3-difluorobenzoyl chloride. InChIKey: BTIZLROTPPAIEJ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O2 |
|---|---|
| Molecular weight | 220.60 g/mol |
| IUPAC name | 4-ethoxy-2,3-difluorobenzoyl chloride |
| InChIKey | BTIZLROTPPAIEJ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)C(=O)Cl)F)F |
Computed by PubChem (NCBI)