Products 1017779-90-6

CAS 1017779-90-6 is the registry number for 3-Ethoxy-2,4-difluorobenzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-ethoxy-2,4-difluorobenzoyl chloride (CAS 1017779-90-6) is a chemical compound with the molecular formula C9H7ClF2O2 and a molecular weight of 220.60 g/mol. IUPAC name: 3-ethoxy-2,4-difluorobenzoyl chloride. InChIKey: WMLHUPZOTFCPNP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7ClF2O2
Molecular weight220.60 g/mol
IUPAC name3-ethoxy-2,4-difluorobenzoyl chloride
InChIKeyWMLHUPZOTFCPNP-UHFFFAOYSA-N
SMILESCCOC1=C(C=CC(=C1F)C(=O)Cl)F

Computed by PubChem (NCBI)