CAS 1017779-90-6 is the registry number for 3-Ethoxy-2,4-difluorobenzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-ethoxy-2,4-difluorobenzoyl chloride (CAS 1017779-90-6) is a chemical compound with the molecular formula C9H7ClF2O2 and a molecular weight of 220.60 g/mol. IUPAC name: 3-ethoxy-2,4-difluorobenzoyl chloride. InChIKey: WMLHUPZOTFCPNP-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O2 |
|---|---|
| Molecular weight | 220.60 g/mol |
| IUPAC name | 3-ethoxy-2,4-difluorobenzoyl chloride |
| InChIKey | WMLHUPZOTFCPNP-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1F)C(=O)Cl)F |
Computed by PubChem (NCBI)