CAS 1263283-69-7 appears in our catalog under these names: Methyl 4-(chloromethyl)-3,5-difluorobenzoate, 95%, Methyl 4-(chloromethyl)-3,5-difluorobenzoate 98%, Methyl 4-(chloromethyl)-3,5-difluorobenzoate, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
Methyl 4-(chloromethyl)-3,5-difluorobenzoate (CAS 1263283-69-7) is a chemical compound with the molecular formula C9H7ClF2O2 and a molecular weight of 220.60 g/mol. IUPAC name: methyl 4-(chloromethyl)-3,5-difluorobenzoate. InChIKey: RWNXTXQXCJVRLY-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O2 |
|---|---|
| Molecular weight | 220.60 g/mol |
| IUPAC name | methyl 4-(chloromethyl)-3,5-difluorobenzoate |
| InChIKey | RWNXTXQXCJVRLY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)F)CCl)F |
Computed by PubChem (NCBI)