CAS 1239592-10-9 appears in our catalog under these names: Ethyl 5-chloro-2,4-difluorobenzoate, 95%, Ethyl 5-chloro-2,4-difluorobenzoate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
Ethyl 5-chloro-2,4-difluorobenzoate (CAS 1239592-10-9) is a chemical compound with the molecular formula C9H7ClF2O2 and a molecular weight of 220.60 g/mol. IUPAC name: ethyl 5-chloro-2,4-difluorobenzoate. InChIKey: KLOWKADDOFKRKP-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O2 |
|---|---|
| Molecular weight | 220.60 g/mol |
| IUPAC name | ethyl 5-chloro-2,4-difluorobenzoate |
| InChIKey | KLOWKADDOFKRKP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1F)F)Cl |
Computed by PubChem (NCBI)