cas: 872141-25-8 — see every product listed under this CAS number, including other names
2-(3-Fluoro-2-nitrophenyl)acetic acid 97% (CAS 872141-25-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A107189-100mg |
| cas | 872141-25-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 214.62 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1143.56 Pln | |
| Ambeed | 25g | 3841.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A107189 |
2-(3-fluoro-2-nitrophenyl)acetic acid (CAS 872141-25-8) is a chemical compound with the molecular formula C8H6FNO4 and a molecular weight of 199.14 g/mol. IUPAC name: 2-(3-fluoro-2-nitrophenyl)acetic acid. InChIKey: ZHQHUGDDYSPNTM-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO4 |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | 2-(3-fluoro-2-nitrophenyl)acetic acid |
| InChIKey | ZHQHUGDDYSPNTM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)[N+](=O)[O-])CC(=O)O |
Computed by PubChem (NCBI)