2-(3-Fluoro-2-nitrophenyl)acetic acid, 98%
cas: 872141-25-8 — see every product listed under this CAS number, including other names
2-(3-Fluoro-2-nitrophenyl)acetic acid, 98% (CAS 872141-25-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g, 100g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch114ETT-100mg |
| cas | 872141-25-8 |
| size | 100mg |
| availability | 100g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 323.60 Pln | |
| Chemat | 5g | 890.00 Pln | |
| Chemat | 25g | 2973.20 Pln | |
| Fluorochem | 100mg | 211.40 Pln | |
| Fluorochem | 250mg | 258.26 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1185.02 Pln | |
| Fluorochem | 10g | 2184.66 Pln | |
| Fluorochem | 25g | 3965.29 Pln | |
| Fluorochem | 100g | 12493.54 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(3-fluoro-2-nitrophenyl)acetic acid (CAS 872141-25-8) is a chemical compound with the molecular formula C8H6FNO4 and a molecular weight of 199.14 g/mol. IUPAC name: 2-(3-fluoro-2-nitrophenyl)acetic acid. InChIKey: ZHQHUGDDYSPNTM-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO4 |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | 2-(3-fluoro-2-nitrophenyl)acetic acid |
| InChIKey | ZHQHUGDDYSPNTM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)[N+](=O)[O-])CC(=O)O |
Computed by PubChem (NCBI)