cas: 163395-24-2 — see every product listed under this CAS number, including other names
2-(3-Fluoro-4-nitrophenyl)acetic acid 95% (CAS 163395-24-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A243574-10g |
| cas | 163395-24-2 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 2834.56 Pln | |
| Ambeed | 1g | 476.06 Pln | |
| Ambeed | 5g | 1799.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A243574 |
2-(3-fluoro-4-nitrophenyl)acetic acid (CAS 163395-24-2) is a chemical compound with the molecular formula C8H6FNO4 and a molecular weight of 199.14 g/mol. IUPAC name: 2-(3-fluoro-4-nitrophenyl)acetic acid. InChIKey: BRWLAOKLDCMHIC-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO4 |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | 2-(3-fluoro-4-nitrophenyl)acetic acid |
| InChIKey | BRWLAOKLDCMHIC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)