cas: 163395-24-2 — see every product listed under this CAS number, including other names
2-(3-Fluoro-4-nitrophenyl)acetic acid (CAS 163395-24-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F234375-250MG |
| cas | 163395-24-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 1g | 778.91 Pln | |
| Fluorochem | 5g | 3137.45 Pln |
| delivery time | 3-4 weeks |
|---|
2-(3-fluoro-4-nitrophenyl)acetic acid (CAS 163395-24-2) is a chemical compound with the molecular formula C8H6FNO4 and a molecular weight of 199.14 g/mol. IUPAC name: 2-(3-fluoro-4-nitrophenyl)acetic acid. InChIKey: BRWLAOKLDCMHIC-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO4 |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | 2-(3-fluoro-4-nitrophenyl)acetic acid |
| InChIKey | BRWLAOKLDCMHIC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)