cas: 13682-18-3 — see every product listed under this CAS number, including other names
2-(3-NITROPHENYL)-IMIDAZOLE, 98% (CAS 13682-18-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F300971-1G |
| cas | 13682-18-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 331.15 Pln | |
| Fluorochem | 5g | 1070.47 Pln | |
| Fluorochem | 10g | 2080.54 Pln | |
| Fluorochem | 25g | 3673.72 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(3-nitrophenyl)-1H-imidazole (CAS 13682-18-3) is a chemical compound with the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. IUPAC name: 2-(3-nitrophenyl)-1H-imidazole. InChIKey: ZPWKGNWCVRBHJB-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 2-(3-nitrophenyl)-1H-imidazole |
| InChIKey | ZPWKGNWCVRBHJB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=NC=CN2 |
Computed by PubChem (NCBI)