CAS 162848-16-0 appears in our catalog under these names: 4-(1H-1,2,4-Triazol-1-yl)benzoic acid, 98%, 4–(1,2,4–Triazol–1–yl)benzoic Acid, 4-(1H-1,2,4-Triazol-1-yl)benzoic acid, 95% , 4-[1,2,4]Triazol-1-yl-benzoic acid, 95%, 95%, 4-(1H-1,2,4-Triazol-1-yl)benzoic acid, 95%. Offered by: Combi-blocks, GLPBio, Thermo Scientific, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250MG, 100mg, 2.5g.
4-(1,2,4-triazol-1-yl)benzoic acid (CAS 162848-16-0) is a chemical compound with the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. IUPAC name: 4-(1,2,4-triazol-1-yl)benzoic acid. InChIKey: FOMQQGKCPYKKHQ-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 4-(1,2,4-triazol-1-yl)benzoic acid |
| InChIKey | FOMQQGKCPYKKHQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)N2C=NC=N2 |
Computed by PubChem (NCBI)