cas: 148324-47-4 — see every product listed under this CAS number, including other names
2-(4-(Benzyloxy)styryl)-6-hydroxybenzoic acid, 95%, 95% (CAS 148324-47-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JIL0-1g |
| cas | 148324-47-4 |
| size | 1g |
| availability | 22g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 9582.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-hydroxy-6-[(E)-2-(4-phenylmethoxyphenyl)ethenyl]benzoic acid (CAS 148324-47-4) is a chemical compound with the molecular formula C22H18O4 and a molecular weight of 346.4 g/mol. IUPAC name: 2-hydroxy-6-[(E)-2-(4-phenylmethoxyphenyl)ethenyl]benzoic acid. InChIKey: VWZWUULAXUNKKP-FMIVXFBMSA-N.
| Molecular formula | C22H18O4 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 2-hydroxy-6-[(E)-2-(4-phenylmethoxyphenyl)ethenyl]benzoic acid |
| InChIKey | VWZWUULAXUNKKP-FMIVXFBMSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)/C=C/C3=C(C(=CC=C3)O)C(=O)O |
Computed by PubChem (NCBI)