2-(4-Acetylphenyl)thiazole-5-carboxylic acid, 95%
cas: 2059934-83-5 — see every product listed under this CAS number, including other names
2-(4-Acetylphenyl)thiazole-5-carboxylic acid, 95% (CAS 2059934-83-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1100810-50mg |
| cas | 2059934-83-5 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 364.81 Pln | |
| Ambeed | 100mg | 570.62 Pln | |
| Ambeed | 250mg | 976.69 Pln | |
| Ambeed | 1g | 2506.38 Pln | |
| Ambeed | 5g | 8224.62 Pln | |
| BLDpharm | 50mg | 392.11 Pln | |
| BLDpharm | 100mg | 614.25 Pln | |
| BLDpharm | 250mg | 1047.43 Pln | |
| BLDpharm | 1g | 2696.85 Pln | |
| BLDpharm | 5g | 8861.35 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-(4-acetylphenyl)-1,3-thiazole-5-carboxylic acid (CAS 2059934-83-5) is a chemical compound with the molecular formula C12H9NO3S and a molecular weight of 247.27 g/mol. IUPAC name: 2-(4-acetylphenyl)-1,3-thiazole-5-carboxylic acid. InChIKey: QYWIIHWVCOOLBC-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3S |
|---|---|
| Molecular weight | 247.27 g/mol |
| IUPAC name | 2-(4-acetylphenyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | QYWIIHWVCOOLBC-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C2=NC=C(S2)C(=O)O |
Computed by PubChem (NCBI)