Products 878465-86-2
CAS 878465-86-2 appears in our catalog under these names: 2-(Thiophene-3-amido)benzoic acid, 97%, 2-[(THIEN-3-YLCARBONYL)AMINO]BENZOIC ACID, 97%, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg.
2-(thiophene-3-carbonylamino)benzoic acid (CAS 878465-86-2) is a chemical compound with the molecular formula C12H9NO3S and a molecular weight of 247.27 g/mol. IUPAC name: 2-(thiophene-3-carbonylamino)benzoic acid. InChIKey: JVNPVDJFOUFLKM-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3S |
|---|---|
| Molecular weight | 247.27 g/mol |
| IUPAC name | 2-(thiophene-3-carbonylamino)benzoic acid |
| InChIKey | JVNPVDJFOUFLKM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NC(=O)C2=CSC=C2 |
Computed by PubChem (NCBI)