CAS 368869-97-0 appears in our catalog under these names: 2-(2,3-Dihydro-1-benzofuran-5-yl)-1,3-thiazole-4-carboxylic acid, 95%, 2-(2,3-Dihydrobenzofuran-5-yl)thiazole-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 25g.
2-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-4-carboxylic acid (CAS 368869-97-0) is a chemical compound with the molecular formula C12H9NO3S and a molecular weight of 247.27 g/mol. IUPAC name: 2-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-4-carboxylic acid. InChIKey: NOUOFPSRFBTJCH-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3S |
|---|---|
| Molecular weight | 247.27 g/mol |
| IUPAC name | 2-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | NOUOFPSRFBTJCH-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2)C3=NC(=CS3)C(=O)O |
Computed by PubChem (NCBI)