CAS 1558352-96-7 appears in our catalog under these names: 2-(2,3-Dihydrobenzofuran-2-yl)thiazole-4-carboxylic acid, 95%, 2-(2,3-dihydro-1-benzofuran-2-yl)-1,3-thiazole-4-carboxylic acid, >95%, >95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-(2,3-dihydro-1-benzofuran-2-yl)-1,3-thiazole-4-carboxylic acid (CAS 1558352-96-7) is a chemical compound with the molecular formula C12H9NO3S and a molecular weight of 247.27 g/mol. IUPAC name: 2-(2,3-dihydro-1-benzofuran-2-yl)-1,3-thiazole-4-carboxylic acid. InChIKey: NVEHYWYZSSAQOQ-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3S |
|---|---|
| Molecular weight | 247.27 g/mol |
| IUPAC name | 2-(2,3-dihydro-1-benzofuran-2-yl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | NVEHYWYZSSAQOQ-UHFFFAOYSA-N |
| SMILES | C1C(OC2=CC=CC=C21)C3=NC(=CS3)C(=O)O |
Computed by PubChem (NCBI)