CAS 1157331-90-2 appears in our catalog under these names: 2-(2,3-Dihydro-1-benzofuran-5-yl)-1,3-thiazole-5-carboxylic acid, 95%, 2-(2,3-Dihydro-1-benzofuran-5-yl)-1,3-thiazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-5-carboxylic acid (CAS 1157331-90-2) is a chemical compound with the molecular formula C12H9NO3S and a molecular weight of 247.27 g/mol. IUPAC name: 2-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-5-carboxylic acid. InChIKey: IWNHLYGNTGDUNG-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3S |
|---|---|
| Molecular weight | 247.27 g/mol |
| IUPAC name | 2-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | IWNHLYGNTGDUNG-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2)C3=NC=C(S3)C(=O)O |
Computed by PubChem (NCBI)