Products 2874379-99-2
CAS 2874379-99-2 is the registry number for 2-(2,3-Dihydrobenzofuran-6-yl)thiazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,3-dihydro-1-benzofuran-6-yl)-1,3-thiazole-4-carboxylic acid (CAS 2874379-99-2) is a chemical compound with the molecular formula C12H9NO3S and a molecular weight of 247.27 g/mol. IUPAC name: 2-(2,3-dihydro-1-benzofuran-6-yl)-1,3-thiazole-4-carboxylic acid. InChIKey: NMGGIJMNVIKXAH-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3S |
|---|---|
| Molecular weight | 247.27 g/mol |
| IUPAC name | 2-(2,3-dihydro-1-benzofuran-6-yl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | NMGGIJMNVIKXAH-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=CC(=C2)C3=NC(=CS3)C(=O)O |
Computed by PubChem (NCBI)