CAS 70013-40-0 is the registry number for 1-[5-(2-Nitrophenyl)thien-2-yl]ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
1-[5-(2-nitrophenyl)thiophen-2-yl]ethanone (CAS 70013-40-0) is a chemical compound with the molecular formula C12H9NO3S and a molecular weight of 247.27 g/mol. IUPAC name: 1-[5-(2-nitrophenyl)thiophen-2-yl]ethanone. InChIKey: LOTZHTNRBWCOJB-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3S |
|---|---|
| Molecular weight | 247.27 g/mol |
| IUPAC name | 1-[5-(2-nitrophenyl)thiophen-2-yl]ethanone |
| InChIKey | LOTZHTNRBWCOJB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(S1)C2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)