cas: 89245-41-0 — see every product listed under this CAS number, including other names
2-(4-Bromo-1H-indol-3-yl)acetic acid, 98%, 98% (CAS 89245-41-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1153IQ-100mg |
| cas | 89245-41-0 |
| size | 100mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 222.80 Pln | |
| Chemat | 5g | 856.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(4-bromo-1H-indol-3-yl)acetic acid (CAS 89245-41-0) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: 2-(4-bromo-1H-indol-3-yl)acetic acid. InChIKey: AQIDQZFQDRENOY-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 2-(4-bromo-1H-indol-3-yl)acetic acid |
| InChIKey | AQIDQZFQDRENOY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=CN2)CC(=O)O |
Computed by PubChem (NCBI)