cas: 89245-41-0 — see every product listed under this CAS number, including other names
4–Bromoindole–3–acetic Acid (CAS 89245-41-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF26225-10g |
| cas | 89245-41-0 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 3395.98 Pln | |
| GLPBio | 1g | 1083.81 Pln | |
| GLPBio | 250mg | 662.57 Pln | |
| GLPBio | 5g | 2010.55 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(4-bromo-1H-indol-3-yl)acetic acid (CAS 89245-41-0) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: 2-(4-bromo-1H-indol-3-yl)acetic acid. InChIKey: AQIDQZFQDRENOY-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 2-(4-bromo-1H-indol-3-yl)acetic acid |
| InChIKey | AQIDQZFQDRENOY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=CN2)CC(=O)O |
Computed by PubChem (NCBI)