cas: 859932-64-2 — see every product listed under this CAS number, including other names
2-(4-Chlorophenyl)-2-oxoacetaldehyde hydrate 97% (CAS 859932-64-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A201821-250mg |
| cas | 859932-64-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1527.38 Pln | |
| Ambeed | 25g | 5176.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A201821 |
2-(4-chlorophenyl)-2-oxoacetaldehyde;hydrate (CAS 859932-64-2) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: 2-(4-chlorophenyl)-2-oxoacetaldehyde;hydrate. InChIKey: JTOCXCVDVKZPEB-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-2-oxoacetaldehyde;hydrate |
| InChIKey | JTOCXCVDVKZPEB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C=O)Cl.O |
Computed by PubChem (NCBI)