cas: 4143-63-9 — see every product listed under this CAS number, including other names
2-(4-Hydroxyphenyl)-4H-chromen-4-one, 97% (CAS 4143-63-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 100mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A296475-5g |
| cas | 4143-63-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 5909.47 Pln | |
| AmBeed | 250mg | 740.53 Pln | |
| Fluorochem | 100mg | 596.68 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(4-hydroxyphenyl)chromen-4-one (CAS 4143-63-9) is a chemical compound with the molecular formula C15H10O3 and a molecular weight of 238.24 g/mol. IUPAC name: 2-(4-hydroxyphenyl)chromen-4-one. InChIKey: SHGLJXBLXNNCTE-UHFFFAOYSA-N.
| Molecular formula | C15H10O3 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 2-(4-hydroxyphenyl)chromen-4-one |
| InChIKey | SHGLJXBLXNNCTE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C=C(O2)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)