CAS 4143-63-9 appears in our catalog under these names: 4'-Hydroxyflavone, 95%, 2-(4-Hydroxyphenyl)-4H-chromen-4-one, 97%, 4'-Hydroxyflavone/ 99.42% (existing batch purity), 4'-Hydroxyflavone, 4'-Hydroxyflavone, >98.0%(GC)(T). Offered by: Combi-blocks, AmBeed, TargetMol, Biosynth, TCI. Available pack sizes: 1g, 5g, 250mg, 1mg, 5mg, 10mg, 25mg, 50mg.
2-(4-hydroxyphenyl)chromen-4-one (CAS 4143-63-9) is a chemical compound with the molecular formula C15H10O3 and a molecular weight of 238.24 g/mol. IUPAC name: 2-(4-hydroxyphenyl)chromen-4-one. InChIKey: SHGLJXBLXNNCTE-UHFFFAOYSA-N.
| Molecular formula | C15H10O3 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 2-(4-hydroxyphenyl)chromen-4-one |
| InChIKey | SHGLJXBLXNNCTE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C=C(O2)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)