cas: 4143-63-9 — see every product listed under this CAS number, including other names
2-(4-Hydroxyphenyl)-4H-chromen-4-one (CAS 4143-63-9) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BZAS-200mg |
| cas | 4143-63-9 |
| size | 200mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 189.20 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 486.80 Pln | |
| Chemat | 5g | 1168.40 Pln |
| delivery time | 3 weeks |
|---|
2-(4-hydroxyphenyl)chromen-4-one (CAS 4143-63-9) is a chemical compound with the molecular formula C15H10O3 and a molecular weight of 238.24 g/mol. IUPAC name: 2-(4-hydroxyphenyl)chromen-4-one. InChIKey: SHGLJXBLXNNCTE-UHFFFAOYSA-N.
| Molecular formula | C15H10O3 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 2-(4-hydroxyphenyl)chromen-4-one |
| InChIKey | SHGLJXBLXNNCTE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C=C(O2)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)