CAS 85107-43-3 appears in our catalog under these names: 4–nitrophenylboronic acid–1,3–propanediol ester, 2-(4-Nitrophenyl)-1,3,2-dioxaborinane, 98%, 98%, 2-(4-Nitrophenyl)-1,3,2-dioxaborinane, 98%. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 1g, 5g, 250mg.
2-(4-nitrophenyl)-1,3,2-dioxaborinane (CAS 85107-43-3) is a chemical compound with the molecular formula C9H10BNO4 and a molecular weight of 206.99 g/mol. IUPAC name: 2-(4-nitrophenyl)-1,3,2-dioxaborinane. InChIKey: XDVUGAYZMIDGEX-UHFFFAOYSA-N.
| Molecular formula | C9H10BNO4 |
|---|---|
| Molecular weight | 206.99 g/mol |
| IUPAC name | 2-(4-nitrophenyl)-1,3,2-dioxaborinane |
| InChIKey | XDVUGAYZMIDGEX-UHFFFAOYSA-N |
| SMILES | B1(OCCCO1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)