cas: 1854670-44-2 — see every product listed under this CAS number, including other names
2-(6-Hydroxypyridin-3-yl)isoindole-1,3-dione, 95%, 95% (CAS 1854670-44-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JT9A-100mg |
| cas | 1854670-44-2 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 750.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(6-oxo-1H-pyridin-3-yl)isoindole-1,3-dione (CAS 1854670-44-2) is a chemical compound with the molecular formula C13H8N2O3 and a molecular weight of 240.21 g/mol. IUPAC name: 2-(6-oxo-1H-pyridin-3-yl)isoindole-1,3-dione. InChIKey: OWNKBSYSJRIRSI-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O3 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 2-(6-oxo-1H-pyridin-3-yl)isoindole-1,3-dione |
| InChIKey | OWNKBSYSJRIRSI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C3=CNC(=O)C=C3 |
Computed by PubChem (NCBI)