CAS 2229373-44-6 is the registry number for 5-(Quinolin-3-yl)isoxazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-quinolin-3-yl-1,2-oxazole-3-carboxylic acid (CAS 2229373-44-6) is a chemical compound with the molecular formula C13H8N2O3 and a molecular weight of 240.21 g/mol. IUPAC name: 5-quinolin-3-yl-1,2-oxazole-3-carboxylic acid. InChIKey: QBZZRGRSCWVOEH-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O3 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 5-quinolin-3-yl-1,2-oxazole-3-carboxylic acid |
| InChIKey | QBZZRGRSCWVOEH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=N2)C3=CC(=NO3)C(=O)O |
Computed by PubChem (NCBI)