CAS 113344-23-3 is the registry number for 4-(2-Nitrophenoxy)benzonitrile, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
4-(2-nitrophenoxy)benzonitrile (CAS 113344-23-3) is a chemical compound with the molecular formula C13H8N2O3 and a molecular weight of 240.21 g/mol. IUPAC name: 4-(2-nitrophenoxy)benzonitrile. InChIKey: AKLSEFOAGVCQDZ-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O3 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 4-(2-nitrophenoxy)benzonitrile |
| InChIKey | AKLSEFOAGVCQDZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])OC2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)