CAS 53946-49-9 is the registry number for 4-Oxo-1,4-dihydro-1,10-phenanthroline-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-oxo-1H-1,10-phenanthroline-3-carboxylic acid (CAS 53946-49-9) is a chemical compound with the molecular formula C13H8N2O3 and a molecular weight of 240.21 g/mol. IUPAC name: 4-oxo-1H-1,10-phenanthroline-3-carboxylic acid. InChIKey: XZZHOJONZJQARN-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O3 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 4-oxo-1H-1,10-phenanthroline-3-carboxylic acid |
| InChIKey | XZZHOJONZJQARN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C(C=C2)C(=O)C(=CN3)C(=O)O)N=C1 |
Computed by PubChem (NCBI)