CAS 24386-17-2 appears in our catalog under these names: 2-Amino-3-cyano-4,5-di(fur-2-yl)furan, 95%, 2-Amino-3-cyano-4,5-di(fur-2-yl)furan, 97% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 1g, 250mg, 5g.
2-amino-4,5-bis(furan-2-yl)furan-3-carbonitrile (CAS 24386-17-2) is a chemical compound with the molecular formula C13H8N2O3 and a molecular weight of 240.21 g/mol. IUPAC name: 2-amino-4,5-bis(furan-2-yl)furan-3-carbonitrile. InChIKey: RDQSOEAGWZLHBE-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O3 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 2-amino-4,5-bis(furan-2-yl)furan-3-carbonitrile |
| InChIKey | RDQSOEAGWZLHBE-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=C(OC(=C2C#N)N)C3=CC=CO3 |
Computed by PubChem (NCBI)