CAS 1284399-56-9 is the registry number for 2-(4-Hydroxyphenyl)-1h-pyrrolo[3,4-c]pyridine-1,3(2h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-(4-hydroxyphenyl)pyrrolo[3,4-c]pyridine-1,3-dione (CAS 1284399-56-9) is a chemical compound with the molecular formula C13H8N2O3 and a molecular weight of 240.21 g/mol. IUPAC name: 2-(4-hydroxyphenyl)pyrrolo[3,4-c]pyridine-1,3-dione. InChIKey: MXFUVJSPJIKCST-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O3 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 2-(4-hydroxyphenyl)pyrrolo[3,4-c]pyridine-1,3-dione |
| InChIKey | MXFUVJSPJIKCST-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C3=C(C2=O)C=NC=C3)O |
Computed by PubChem (NCBI)