CAS 1009820-31-8 is the registry number for 5-Oxo-5,6-dihydrobenzo[c][2,6]naphthyridine-8-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-oxo-6H-benzo[c][2,6]naphthyridine-8-carboxylic acid (CAS 1009820-31-8) is a chemical compound with the molecular formula C13H8N2O3 and a molecular weight of 240.21 g/mol. IUPAC name: 5-oxo-6H-benzo[c][2,6]naphthyridine-8-carboxylic acid. InChIKey: FNBQKJSMQWRTEK-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O3 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 5-oxo-6H-benzo[c][2,6]naphthyridine-8-carboxylic acid |
| InChIKey | FNBQKJSMQWRTEK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)NC(=O)C3=C2C=NC=C3 |
Computed by PubChem (NCBI)