cas: 125700-33-6 — see every product listed under this CAS number, including other names
2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)acetic acid, ≥99 atom% 15N,≥98.5%, ≥99 atom% 15N,≥98.5% (CAS 125700-33-6) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111OI4-25mg |
| cas | 125700-33-6 |
| size | 25mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 534.80 Pln | |
| Chemat | 100mg | 1638.80 Pln |
| purity | ≥99 atom% 15N,≥98.5% |
|---|---|
| delivery time | 3 weeks |
2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)acetic acid (CAS 125700-33-6) is a chemical compound with the molecular formula C17H15NO4 and a molecular weight of 298.30 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)acetic acid. InChIKey: NDKDFTQNXLHCGO-CPZJZEHKSA-N.
| Molecular formula | C17H15NO4 |
|---|---|
| Molecular weight | 298.30 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)acetic acid |
| InChIKey | NDKDFTQNXLHCGO-CPZJZEHKSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)[15NH]CC(=O)O |
Computed by PubChem (NCBI)