cas: 125700-33-6 — see every product listed under this CAS number, including other names
Fmoc–Gly–OH–15N (CAS 125700-33-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10mg, 100mg, 25mg, 50mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF11403-5g |
| cas | 125700-33-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 5g | 3658.09 Pln | |
| GLPBio | 10mg | 625.12 Pln | |
| GLPBio | 100mg | 1636.11 Pln | |
| GLPBio | 25mg | 877.87 Pln | |
| GLPBio | 50mg | 1172.74 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)acetic acid (CAS 125700-33-6) is a chemical compound with the molecular formula C17H15NO4 and a molecular weight of 298.30 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)acetic acid. InChIKey: NDKDFTQNXLHCGO-CPZJZEHKSA-N.
| Molecular formula | C17H15NO4 |
|---|---|
| Molecular weight | 298.30 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)acetic acid |
| InChIKey | NDKDFTQNXLHCGO-CPZJZEHKSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)[15NH]CC(=O)O |
Computed by PubChem (NCBI)