cas: 1492563-70-8 — see every product listed under this CAS number, including other names
2-(Benzo[d][1,3]dioxol-4-yl)-2-oxoacetic acid, 95% (CAS 1492563-70-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1811436-250mg |
| cas | 1492563-70-8 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1688.69 Pln | |
| Ambeed | 1g | 4558.94 Pln | |
| BLDpharm | 100mg | 953.02 Pln | |
| BLDpharm | 250mg | 1658.33 Pln | |
| BLDpharm | 1g | 4462.90 Pln | |
| Chemat | 100mg | 827.60 Pln | |
| Chemat | 250mg | 1437.20 Pln | |
| Chemat | 1g | 4048.40 Pln | |
| Fluorochem | 100mg | 1539.06 Pln | |
| Fluorochem | 250mg | 2674.08 Pln | |
| Fluorochem | 1g | 7370.34 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-(1,3-benzodioxol-4-yl)-2-oxoacetic acid (CAS 1492563-70-8) is a chemical compound with the molecular formula C9H6O5 and a molecular weight of 194.14 g/mol. IUPAC name: 2-(1,3-benzodioxol-4-yl)-2-oxoacetic acid. InChIKey: NVLCGBWRICWMLO-UHFFFAOYSA-N.
| Molecular formula | C9H6O5 |
|---|---|
| Molecular weight | 194.14 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-4-yl)-2-oxoacetic acid |
| InChIKey | NVLCGBWRICWMLO-UHFFFAOYSA-N |
| SMILES | C1OC2=CC=CC(=C2O1)C(=O)C(=O)O |
Computed by PubChem (NCBI)